C18H22Cl2N4 — CID 110970221
1-[2-(2,6-dichlorophenyl)propyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine (PubChem CID 110970221) has the molecular formula C18H22Cl2N4 and a molecular weight of 365.31 g/mol. Its IUPAC name is 1-[2-(2,6-dichlorophenyl)propyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(2,6-dichlorophenyl)propyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110970221 |
| Molecular Formula | C18H22Cl2N4 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-[2-(2,6-dichlorophenyl)propyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccccn1)NCC(C)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H22Cl2N4/c1-3-21-18(24-12-14-7-4-5-10-22-14)23-11-13(2)17-15(19)8-6-9-16(17)20/h4-10,13H,3,11-12H2,1-2H3,(H2,21,23,24) |
| InChIKey | IYCNMVMQJKUVBY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|