C15H27NO2 — CID 11097107
(4S,5R)-4-methyl-5-undec-10-enyl-1,3-oxazolidin-2-one (PubChem CID 11097107) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is (4S,5R)-4-methyl-5-undec-10-enyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-4-methyl-5-undec-10-enyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11097107 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (4S,5R)-4-methyl-5-undec-10-enyl-1,3-oxazolidin-2-one |
| SMILES | C=CCCCCCCCCC[C@H]1OC(=O)N[C@H]1C |
| InChI | InChI=1S/C15H27NO2/c1-3-4-5-6-7-8-9-10-11-12-14-13(2)16-15(17)18-14/h3,13-14H,1,4-12H2,2H3,(H,16,17)/t13-,14+/m0/s1 |
| InChIKey | PTYJLTBFLDJKND-UONOGXRCSA-N |
| XLogP | 4.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|