C13H18O5 — CID 11097119
(2S,3S,4R,5S,6R)-2-methyl-6-phenylmethoxyoxane-3,4,5-triol (PubChem CID 11097119) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-2-methyl-6-phenylmethoxyoxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S,6R)-2-methyl-6-phenylmethoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 11097119 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (2S,3S,4R,5S,6R)-2-methyl-6-phenylmethoxyoxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@@H](OCc2ccccc2)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H18O5/c1-8-10(14)11(15)12(16)13(18-8)17-7-9-5-3-2-4-6-9/h2-6,8,10-16H,7H2,1H3/t8-,10+,11+,12-,13+/m0/s1 |
| InChIKey | UHQDDNIUJBFOEL-ZYJFBCHUSA-N |
| XLogP | 0.03 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |