C13H22O3Si — CID 11097144
ethyl (3aS,6S,7R,7aS)-1,1,6-trimethyl-3a,6,7,7a-tetrahydro-3H-2,1-benzoxasilole-7-carboxylate (PubChem CID 11097144) has the molecular formula C13H22O3Si and a molecular weight of 254.40 g/mol. Its IUPAC name is ethyl (3aS,6S,7R,7aS)-1,1,6-trimethyl-3a,6,7,7a-tetrahydro-3H-2,1-benzoxasilole-7-carboxylate.
| Compound Name | ethyl (3aS,6S,7R,7aS)-1,1,6-trimethyl-3a,6,7,7a-tetrahydro-3H-2,1-benzoxasilole-7-carboxylate |
|---|---|
| PubChem CID | 11097144 |
| Molecular Formula | C13H22O3Si |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | ethyl (3aS,6S,7R,7aS)-1,1,6-trimethyl-3a,6,7,7a-tetrahydro-3H-2,1-benzoxasilole-7-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2[C@@H](C=C[C@@H]1C)CO[Si]2(C)C |
| InChI | InChI=1S/C13H22O3Si/c1-5-15-13(14)11-9(2)6-7-10-8-16-17(3,4)12(10)11/h6-7,9-12H,5,8H2,1-4H3/t9-,10-,11-,12-/m0/s1 |
| InChIKey | UQYHFQBPVYXYMG-BJDJZHNGSA-N |
| XLogP | 2.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|