C20H32N6O3 — CID 110971449
N-(2-amino-2-oxoethyl)-4-[[[ethylamino-(3-morpholin-4-ylpropylamino)methylidene]amino]methyl]benzamide (PubChem CID 110971449) has the molecular formula C20H32N6O3 and a molecular weight of 404.52 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[ethylamino-(3-morpholin-4-ylpropylamino)methylidene]amino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[ethylamino-(3-morpholin-4-ylpropylamino)methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 110971449 |
| Molecular Formula | C20H32N6O3 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[ethylamino-(3-morpholin-4-ylpropylamino)methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NCC(N)=O)cc1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C20H32N6O3/c1-2-22-20(23-8-3-9-26-10-12-29-13-11-26)25-14-16-4-6-17(7-5-16)19(28)24-15-18(21)27/h4-7H,2-3,8-15H2,1H3,(H2,21,27)(H,24,28)(H2,22,23,25) |
| InChIKey | LWSQHFJLZLZIPG-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|