C18H29Cl2IN4O2 — CID 110971520
1-[2-(2,3-dichlorophenoxy)ethyl]-3-ethyl-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 110971520) has the molecular formula C18H29Cl2IN4O2 and a molecular weight of 531.27 g/mol. Its IUPAC name is 1-[2-(2,3-dichlorophenoxy)ethyl]-3-ethyl-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,3-dichlorophenoxy)ethyl]-3-ethyl-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110971520 |
| Molecular Formula | C18H29Cl2IN4O2 |
| Molecular Weight | 531.27 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | 1-[2-(2,3-dichlorophenoxy)ethyl]-3-ethyl-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCOCC1)NCCOc1cccc(Cl)c1Cl.I |
| InChI | InChI=1S/C18H28Cl2N4O2.HI/c1-2-21-18(22-7-4-9-24-10-13-25-14-11-24)23-8-12-26-16-6-3-5-15(19)17(16)20;/h3,5-6H,2,4,7-14H2,1H3,(H2,21,22,23);1H |
| InChIKey | DKLFCVDHOGODQH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|