C16H30F3N5O — CID 110971867
1-ethyl-2-(3-morpholin-4-ylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 110971867) has the molecular formula C16H30F3N5O and a molecular weight of 365.44 g/mol. Its IUPAC name is 1-ethyl-2-(3-morpholin-4-ylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-ethyl-2-(3-morpholin-4-ylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 110971867 |
| Molecular Formula | C16H30F3N5O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 1-ethyl-2-(3-morpholin-4-ylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCN/C(=N\CCCN1CCOCC1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C16H30F3N5O/c1-2-20-15(21-5-3-6-23-8-10-25-11-9-23)22-14-4-7-24(12-14)13-16(17,18)19/h14H,2-13H2,1H3,(H2,20,21,22) |
| InChIKey | ARPGLDJHJNKDSX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|