C25H34N6O — CID 110972119
2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-ethyl-3-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 110972119) has the molecular formula C25H34N6O and a molecular weight of 434.59 g/mol. Its IUPAC name is 2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-ethyl-3-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-ethyl-3-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 110972119 |
| Molecular Formula | C25H34N6O |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-ethyl-3-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cn2cnc3ccccc32)cc1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C25H34N6O/c1-2-26-25(27-12-5-13-30-14-16-32-17-15-30)28-18-21-8-10-22(11-9-21)19-31-20-29-23-6-3-4-7-24(23)31/h3-4,6-11,20H,2,5,12-19H2,1H3,(H2,26,27,28) |
| InChIKey | QISJOYPRSYGIEW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|