C21H41N5O2 — CID 110972461
1-ethyl-2-[(1-morpholin-4-ylcyclohexyl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 110972461) has the molecular formula C21H41N5O2 and a molecular weight of 395.59 g/mol. Its IUPAC name is 1-ethyl-2-[(1-morpholin-4-ylcyclohexyl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-ethyl-2-[(1-morpholin-4-ylcyclohexyl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 110972461 |
| Molecular Formula | C21H41N5O2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.33 |
| IUPAC Name | 1-ethyl-2-[(1-morpholin-4-ylcyclohexyl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC1(N2CCOCC2)CCCCC1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C21H41N5O2/c1-2-22-20(23-9-6-10-25-11-15-27-16-12-25)24-19-21(7-4-3-5-8-21)26-13-17-28-18-14-26/h2-19H2,1H3,(H2,22,23,24) |
| InChIKey | UEDIWNOWVFTXNS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|