methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate

C13H26O3Si — CID 11097260

IUPACmethyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate
SMILESCOC(=O)/C=C\C[C@@H](C)O[Si](C)(C)C(C)(C)C
InChIInChI=1S/C13H26O3Si/c1-11(9-8-10-12(14)15-5)16-17(6,7)13(2,3)4/h8,10-11H,9H2,1-7H3/b10-8-/t11-/m1/s1
InChIKeyJZACRADDHGBASF-HIJJYWJESA-N
MW258.43 g/mol
LogP3.52
Rot. Bonds5

About methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate

methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate (PubChem CID 11097260) has the molecular formula C13H26O3Si and a molecular weight of 258.43 g/mol. Its IUPAC name is methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate.

Molecular Properties

Compound Namemethyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate
PubChem CID11097260
Molecular FormulaC13H26O3Si
Molecular Weight258.43 g/mol
Exact Mass258.17
IUPAC Namemethyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate
SMILESCOC(=O)/C=C\C[C@@H](C)O[Si](C)(C)C(C)(C)C
InChIInChI=1S/C13H26O3Si/c1-11(9-8-10-12(14)15-5)16-17(6,7)13(2,3)4/h8,10-11H,9H2,1-7H3/b10-8-/t11-/m1/s1
InChIKeyJZACRADDHGBASF-HIJJYWJESA-N
XLogP3.52
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.43
LogP ≤ 53.52
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate?
The IUPAC name of methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate (CID 11097260) is methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate.
What is the SMILES notation for methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate?
The canonical SMILES for methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate is COC(=O)/C=C\C[C@@H](C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate?
The InChIKey is JZACRADDHGBASF-HIJJYWJESA-N. The full InChI is InChI=1S/C13H26O3Si/c1-11(9-8-10-12(14)15-5)16-17(6,7)13(2,3)4/h8,10-11H,9H2,1-7H3/b10-8-/t11-/m1/s1.
What are the key properties of methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate?
methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate has a molecular weight of 258.43 g/mol, XLogP of 3.52, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate is sourced from PubChem (CID 11097260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).