About 3-nitro-5-(2-phenylethyl)benzene-1,2-diol
3-nitro-5-(2-phenylethyl)benzene-1,2-diol (PubChem CID 11097276) has the molecular formula C14H13NO4
and a molecular weight of 259.26 g/mol. Its IUPAC name is 3-nitro-5-(2-phenylethyl)benzene-1,2-diol.
Molecular Properties
| Compound Name | 3-nitro-5-(2-phenylethyl)benzene-1,2-diol |
| PubChem CID | 11097276 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3-nitro-5-(2-phenylethyl)benzene-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(CCc2ccccc2)cc(O)c1O |
| InChI | InChI=1S/C14H13NO4/c16-13-9-11(8-12(14(13)17)15(18)19)7-6-10-4-2-1-3-5-10/h1-5,8-9,16-17H,6-7H2 |
| InChIKey | IBRPLCDXFQUDAU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-5-(2-phenylethyl)benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-5-(2-phenylethyl)benzene-1,2-diol?
The IUPAC name of 3-nitro-5-(2-phenylethyl)benzene-1,2-diol (CID 11097276) is 3-nitro-5-(2-phenylethyl)benzene-1,2-diol.
What is the SMILES notation for 3-nitro-5-(2-phenylethyl)benzene-1,2-diol?
The canonical SMILES for 3-nitro-5-(2-phenylethyl)benzene-1,2-diol is O=[N+]([O-])c1cc(CCc2ccccc2)cc(O)c1O.
What is the InChIKey of 3-nitro-5-(2-phenylethyl)benzene-1,2-diol?
The InChIKey is IBRPLCDXFQUDAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO4/c16-13-9-11(8-12(14(13)17)15(18)19)7-6-10-4-2-1-3-5-10/h1-5,8-9,16-17H,6-7H2.
What are the key properties of 3-nitro-5-(2-phenylethyl)benzene-1,2-diol?
3-nitro-5-(2-phenylethyl)benzene-1,2-diol has a molecular weight of 259.26 g/mol, XLogP of 2.79, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-5-(2-phenylethyl)benzene-1,2-diol is sourced from PubChem (CID 11097276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).