C14H17NO4 — CID 11097385
benzyl N-[(3S)-5,5-dimethyl-2-oxooxolan-3-yl]carbamate (PubChem CID 11097385) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is benzyl N-[(3S)-5,5-dimethyl-2-oxooxolan-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-5,5-dimethyl-2-oxooxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 11097385 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | benzyl N-[(3S)-5,5-dimethyl-2-oxooxolan-3-yl]carbamate |
| SMILES | CC1(C)C[C@H](NC(=O)OCc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C14H17NO4/c1-14(2)8-11(12(16)19-14)15-13(17)18-9-10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | KWNDZSJEZBTGAF-NSHDSACASA-N |
| XLogP | 2.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |