C12H28N4O — CID 110974949
1-[2-(diethylamino)ethyl]-3-(3-methoxypropyl)-2-methylguanidine (PubChem CID 110974949) has the molecular formula C12H28N4O and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-3-(3-methoxypropyl)-2-methylguanidine.
| Compound Name | 1-[2-(diethylamino)ethyl]-3-(3-methoxypropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 110974949 |
| Molecular Formula | C12H28N4O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.23 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-3-(3-methoxypropyl)-2-methylguanidine |
| SMILES | CCN(CC)CCN/C(=N/C)NCCCOC |
| InChI | InChI=1S/C12H28N4O/c1-5-16(6-2)10-9-15-12(13-3)14-8-7-11-17-4/h5-11H2,1-4H3,(H2,13,14,15) |
| InChIKey | DPTZYKOXFLAEPJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|