C12H23N5O2 — CID 110976051
1-(3-methoxypropyl)-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine (PubChem CID 110976051) has the molecular formula C12H23N5O2 and a molecular weight of 269.35 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine.
| Compound Name | 1-(3-methoxypropyl)-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
|---|---|
| PubChem CID | 110976051 |
| Molecular Formula | C12H23N5O2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 1-(3-methoxypropyl)-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCOC)NCCCc1nc(C)no1 |
| InChI | InChI=1S/C12H23N5O2/c1-10-16-11(19-17-10)6-4-7-14-12(13-2)15-8-5-9-18-3/h4-9H2,1-3H3,(H2,13,14,15) |
| InChIKey | CHCJJVHRBUHYHB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|