C18H24O2 — CID 11097689
2-[1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2-hydroxypropan-2-yl]phenol (PubChem CID 11097689) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-[1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2-hydroxypropan-2-yl]phenol.
| Compound Name | 2-[1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2-hydroxypropan-2-yl]phenol |
|---|---|
| PubChem CID | 11097689 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2-[1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2-hydroxypropan-2-yl]phenol |
| SMILES | CC(O)(CC1=CC[C@H]2C[C@@H]1C2(C)C)c1ccccc1O |
| InChI | InChI=1S/C18H24O2/c1-17(2)13-9-8-12(15(17)10-13)11-18(3,20)14-6-4-5-7-16(14)19/h4-8,13,15,19-20H,9-11H2,1-3H3/t13-,15-,18?/m0/s1 |
| InChIKey | NCOYZFOAKAXXBP-SUAWAIIZSA-N |
| XLogP | 3.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|