C20H34 — CID 11097761
(1R,3aR,7aR)-4-ethenyl-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,6,7-hexahydroindene (PubChem CID 11097761) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is (1R,3aR,7aR)-4-ethenyl-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,6,7-hexahydroindene.
| Compound Name | (1R,3aR,7aR)-4-ethenyl-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,6,7-hexahydroindene |
|---|---|
| PubChem CID | 11097761 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | (1R,3aR,7aR)-4-ethenyl-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,6,7-hexahydroindene |
| SMILES | C=CC1=CCC[C@]2(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C20H34/c1-6-17-11-8-14-20(5)18(12-13-19(17)20)16(4)10-7-9-15(2)3/h6,11,15-16,18-19H,1,7-10,12-14H2,2-5H3/t16-,18-,19+,20-/m1/s1 |
| InChIKey | JTTJUTOHDNXAIN-RSPOEFSDSA-N |
| XLogP | 6.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |