C17H28IN3 — CID 110977782
1-(2,3-dihydro-1H-inden-5-ylmethyl)-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide (PubChem CID 110977782) has the molecular formula C17H28IN3 and a molecular weight of 401.34 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-ylmethyl)-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-ylmethyl)-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110977782 |
| Molecular Formula | C17H28IN3 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-ylmethyl)-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(C)C)NCc1ccc2c(c1)CCC2.I |
| InChI | InChI=1S/C17H27N3.HI/c1-13(2)9-10-19-17(18-3)20-12-14-7-8-15-5-4-6-16(15)11-14;/h7-8,11,13H,4-6,9-10,12H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | ASMOZQMOURWENE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|