C17H29N5O — CID 110978479
N-methyl-2-[[N'-methyl-N-(3-methylbutyl)carbamimidoyl]amino]-N-(2-pyridin-2-ylethyl)acetamide (PubChem CID 110978479) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is N-methyl-2-[[N'-methyl-N-(3-methylbutyl)carbamimidoyl]amino]-N-(2-pyridin-2-ylethyl)acetamide.
| Compound Name | N-methyl-2-[[N'-methyl-N-(3-methylbutyl)carbamimidoyl]amino]-N-(2-pyridin-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 110978479 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | N-methyl-2-[[N'-methyl-N-(3-methylbutyl)carbamimidoyl]amino]-N-(2-pyridin-2-ylethyl)acetamide |
| SMILES | C/N=C(\NCCC(C)C)NCC(=O)N(C)CCc1ccccn1 |
| InChI | InChI=1S/C17H29N5O/c1-14(2)8-11-20-17(18-3)21-13-16(23)22(4)12-9-15-7-5-6-10-19-15/h5-7,10,14H,8-9,11-13H2,1-4H3,(H2,18,20,21) |
| InChIKey | UCBPZPADYGMGDQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|