About N-methyl-N-phenylaniline
N-methyl-N-phenylaniline (PubChem CID 11098) has the molecular formula C13H13N
and a molecular weight of 183.25 g/mol. Its IUPAC name is N-methyl-N-phenylaniline.
Molecular Properties
| Compound Name | N-methyl-N-phenylaniline |
| PubChem CID | 11098 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | N-methyl-N-phenylaniline |
| SMILES | CN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H13N/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | DYFFAVRFJWYYQO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-phenylaniline?
The IUPAC name of N-methyl-N-phenylaniline (CID 11098) is N-methyl-N-phenylaniline.
What is the SMILES notation for N-methyl-N-phenylaniline?
The canonical SMILES for N-methyl-N-phenylaniline is CN(c1ccccc1)c1ccccc1.
What is the InChIKey of N-methyl-N-phenylaniline?
The InChIKey is DYFFAVRFJWYYQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3.
What are the key properties of N-methyl-N-phenylaniline?
N-methyl-N-phenylaniline has a molecular weight of 183.25 g/mol, XLogP of 3.45, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-phenylaniline is sourced from PubChem (CID 11098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).