C13H25N3 — CID 110980059
2-methyl-1-[(2-methylcyclohexyl)methyl]-3-prop-2-enylguanidine (PubChem CID 110980059) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 2-methyl-1-[(2-methylcyclohexyl)methyl]-3-prop-2-enylguanidine.
| Compound Name | 2-methyl-1-[(2-methylcyclohexyl)methyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 110980059 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 2-methyl-1-[(2-methylcyclohexyl)methyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\C)NCC1CCCCC1C |
| InChI | InChI=1S/C13H25N3/c1-4-9-15-13(14-3)16-10-12-8-6-5-7-11(12)2/h4,11-12H,1,5-10H2,2-3H3,(H2,14,15,16) |
| InChIKey | SNVNZCLHCCRVSN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|