C10H22IN3O2 — CID 110980342
1-[2-(2-methoxyethoxy)ethyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide (PubChem CID 110980342) has the molecular formula C10H22IN3O2 and a molecular weight of 343.21 g/mol. Its IUPAC name is 1-[2-(2-methoxyethoxy)ethyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-[2-(2-methoxyethoxy)ethyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110980342 |
| Molecular Formula | C10H22IN3O2 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 1-[2-(2-methoxyethoxy)ethyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\C)NCCOCCOC.I |
| InChI | InChI=1S/C10H21N3O2.HI/c1-4-5-12-10(11-2)13-6-7-15-9-8-14-3;/h4H,1,5-9H2,2-3H3,(H2,11,12,13);1H |
| InChIKey | FNMYHMKXGSUDIS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|