C20H32N4O — CID 110980879
2-[[2-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-1-ethyl-3-prop-2-enylguanidine (PubChem CID 110980879) has the molecular formula C20H32N4O and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-[[2-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-1-ethyl-3-prop-2-enylguanidine.
| Compound Name | 2-[[2-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-1-ethyl-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 110980879 |
| Molecular Formula | C20H32N4O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | 2-[[2-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-1-ethyl-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N/Cc1ccccc1CN1CC(C)OC(C)C1)NCC |
| InChI | InChI=1S/C20H32N4O/c1-5-11-22-20(21-6-2)23-12-18-9-7-8-10-19(18)15-24-13-16(3)25-17(4)14-24/h5,7-10,16-17H,1,6,11-15H2,2-4H3,(H2,21,22,23) |
| InChIKey | GJSUPFPIBACNJW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|