(2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid

C12H22F3NO3 — CID 11098102

IUPAC(2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid
SMILESCCCCCCCC[C@](O)([C@H](N)C(=O)O)C(F)(F)F
InChIInChI=1S/C12H22F3NO3/c1-2-3-4-5-6-7-8-11(19,12(13,14)15)9(16)10(17)18/h9,19H,2-8,16H2,1H3,(H,17,18)/t9-,11+/m1/s1
InChIKeyXITZANYRXPOHMQ-KOLCDFICSA-N
MW285.31 g/mol
LogP2.44
Rot. Bonds9

About (2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid

(2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid (PubChem CID 11098102) has the molecular formula C12H22F3NO3 and a molecular weight of 285.31 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid.

Molecular Properties

Compound Name(2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid
PubChem CID11098102
Molecular FormulaC12H22F3NO3
Molecular Weight285.31 g/mol
Exact Mass285.16
IUPAC Name(2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid
SMILESCCCCCCCC[C@](O)([C@H](N)C(=O)O)C(F)(F)F
InChIInChI=1S/C12H22F3NO3/c1-2-3-4-5-6-7-8-11(19,12(13,14)15)9(16)10(17)18/h9,19H,2-8,16H2,1H3,(H,17,18)/t9-,11+/m1/s1
InChIKeyXITZANYRXPOHMQ-KOLCDFICSA-N
XLogP2.44
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.31
LogP ≤ 52.44
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid?
The IUPAC name of (2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid (CID 11098102) is (2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid.
What is the SMILES notation for (2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid?
The canonical SMILES for (2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid is CCCCCCCC[C@](O)([C@H](N)C(=O)O)C(F)(F)F.
What is the InChIKey of (2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid?
The InChIKey is XITZANYRXPOHMQ-KOLCDFICSA-N. The full InChI is InChI=1S/C12H22F3NO3/c1-2-3-4-5-6-7-8-11(19,12(13,14)15)9(16)10(17)18/h9,19H,2-8,16H2,1H3,(H,17,18)/t9-,11+/m1/s1.
What are the key properties of (2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid?
(2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid has a molecular weight of 285.31 g/mol, XLogP of 2.44, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid is sourced from PubChem (CID 11098102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).