C12H22F3NO3 — CID 11098102
(2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid (PubChem CID 11098102) has the molecular formula C12H22F3NO3 and a molecular weight of 285.31 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid.
| Compound Name | (2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid |
|---|---|
| PubChem CID | 11098102 |
| Molecular Formula | C12H22F3NO3 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | (2S,3S)-2-amino-3-hydroxy-3-(trifluoromethyl)undecanoic acid |
| SMILES | CCCCCCCC[C@](O)([C@H](N)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C12H22F3NO3/c1-2-3-4-5-6-7-8-11(19,12(13,14)15)9(16)10(17)18/h9,19H,2-8,16H2,1H3,(H,17,18)/t9-,11+/m1/s1 |
| InChIKey | XITZANYRXPOHMQ-KOLCDFICSA-N |
| XLogP | 2.44 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|