C12H13FO5S — CID 11098182
2-[4-(2-ethoxy-1-hydroxy-2-oxoethyl)-3-fluorophenyl]sulfanylacetic acid (PubChem CID 11098182) has the molecular formula C12H13FO5S and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-[4-(2-ethoxy-1-hydroxy-2-oxoethyl)-3-fluorophenyl]sulfanylacetic acid.
| Compound Name | 2-[4-(2-ethoxy-1-hydroxy-2-oxoethyl)-3-fluorophenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 11098182 |
| Molecular Formula | C12H13FO5S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-[4-(2-ethoxy-1-hydroxy-2-oxoethyl)-3-fluorophenyl]sulfanylacetic acid |
| SMILES | CCOC(=O)C(O)c1ccc(SCC(=O)O)cc1F |
| InChI | InChI=1S/C12H13FO5S/c1-2-18-12(17)11(16)8-4-3-7(5-9(8)13)19-6-10(14)15/h3-5,11,16H,2,6H2,1H3,(H,14,15) |
| InChIKey | AOVCOSQHVYPZQF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |