C18H28N2O — CID 11098201
N-[[(1R,2R)-2-[(4-methoxyphenyl)methylideneamino]cyclohexyl]methyl]propan-2-amine (PubChem CID 11098201) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is N-[[(1R,2R)-2-[(4-methoxyphenyl)methylideneamino]cyclohexyl]methyl]propan-2-amine.
| Compound Name | N-[[(1R,2R)-2-[(4-methoxyphenyl)methylideneamino]cyclohexyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 11098201 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N-[[(1R,2R)-2-[(4-methoxyphenyl)methylideneamino]cyclohexyl]methyl]propan-2-amine |
| SMILES | COc1ccc(/C=N/[C@@H]2CCCC[C@@H]2CNC(C)C)cc1 |
| InChI | InChI=1S/C18H28N2O/c1-14(2)19-13-16-6-4-5-7-18(16)20-12-15-8-10-17(21-3)11-9-15/h8-12,14,16,18-19H,4-7,13H2,1-3H3/b20-12+/t16-,18-/m1/s1 |
| InChIKey | TUDIRMPHYUEQTK-URFUOSOHSA-N |
| XLogP | 3.67 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|