About [(3S,4S)-3-chlorotetradec-1-en-4-yl] acetate
[(3S,4S)-3-chlorotetradec-1-en-4-yl] acetate (PubChem CID 11098209) has the molecular formula C16H29ClO2
and a molecular weight of 288.86 g/mol. Its IUPAC name is [(3S,4S)-3-chlorotetradec-1-en-4-yl] acetate.
Molecular Properties
| Compound Name | [(3S,4S)-3-chlorotetradec-1-en-4-yl] acetate |
| PubChem CID | 11098209 |
| Molecular Formula | C16H29ClO2 |
| Molecular Weight | 288.86 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | [(3S,4S)-3-chlorotetradec-1-en-4-yl] acetate |
| SMILES | C=C[C@H](Cl)[C@H](CCCCCCCCCC)OC(C)=O |
| InChI | InChI=1S/C16H29ClO2/c1-4-6-7-8-9-10-11-12-13-16(15(17)5-2)19-14(3)18/h5,15-16H,2,4,6-13H2,1,3H3/t15-,16-/m0/s1 |
| InChIKey | MLJQYWCQNKPGNX-HOTGVXAUSA-N |
| XLogP | 5.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.86 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4S)-3-chlorotetradec-1-en-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-3-chlorotetradec-1-en-4-yl] acetate?
The IUPAC name of [(3S,4S)-3-chlorotetradec-1-en-4-yl] acetate (CID 11098209) is [(3S,4S)-3-chlorotetradec-1-en-4-yl] acetate.
What is the SMILES notation for [(3S,4S)-3-chlorotetradec-1-en-4-yl] acetate?
The canonical SMILES for [(3S,4S)-3-chlorotetradec-1-en-4-yl] acetate is C=C[C@H](Cl)[C@H](CCCCCCCCCC)OC(C)=O.
What is the InChIKey of [(3S,4S)-3-chlorotetradec-1-en-4-yl] acetate?
The InChIKey is MLJQYWCQNKPGNX-HOTGVXAUSA-N. The full InChI is InChI=1S/C16H29ClO2/c1-4-6-7-8-9-10-11-12-13-16(15(17)5-2)19-14(3)18/h5,15-16H,2,4,6-13H2,1,3H3/t15-,16-/m0/s1.
What are the key properties of [(3S,4S)-3-chlorotetradec-1-en-4-yl] acetate?
[(3S,4S)-3-chlorotetradec-1-en-4-yl] acetate has a molecular weight of 288.86 g/mol, XLogP of 5.24, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-3-chlorotetradec-1-en-4-yl] acetate is sourced from PubChem (CID 11098209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).