C8H14N6O4S — CID 11098243
(3S,4R,5R,6S)-4,5-diazido-3,6-dimethoxythiepane 1,1-dioxide (PubChem CID 11098243) has the molecular formula C8H14N6O4S and a molecular weight of 290.31 g/mol. Its IUPAC name is (3S,4R,5R,6S)-4,5-diazido-3,6-dimethoxythiepane 1,1-dioxide.
| Compound Name | (3S,4R,5R,6S)-4,5-diazido-3,6-dimethoxythiepane 1,1-dioxide |
|---|---|
| PubChem CID | 11098243 |
| Molecular Formula | C8H14N6O4S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | (3S,4R,5R,6S)-4,5-diazido-3,6-dimethoxythiepane 1,1-dioxide |
| SMILES | CO[C@@H]1CS(=O)(=O)C[C@@H](OC)[C@H](N=[N+]=[N-])[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C8H14N6O4S/c1-17-5-3-19(15,16)4-6(18-2)8(12-14-10)7(5)11-13-9/h5-8H,3-4H2,1-2H3/t5-,6-,7+,8+/m1/s1 |
| InChIKey | GXTXIZFQKUDMFA-NGJRWZKOSA-N |
| XLogP | 0.80 |
| TPSA | 150.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|