C11H22N4O — CID 110983294
3-[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]-N-propylpropanamide (PubChem CID 110983294) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]-N-propylpropanamide.
| Compound Name | 3-[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 110983294 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 3-[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]-N-propylpropanamide |
| SMILES | C=CCN/C(=N\C)NCCC(=O)NCCC |
| InChI | InChI=1S/C11H22N4O/c1-4-7-13-10(16)6-9-15-11(12-3)14-8-5-2/h5H,2,4,6-9H2,1,3H3,(H,13,16)(H2,12,14,15) |
| InChIKey | XVHZQRYDYOCMDB-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|