About 6-methoxy-2,2-dimethyl-4-phenylsulfanylocta-4,5-dien-3-ol
6-methoxy-2,2-dimethyl-4-phenylsulfanylocta-4,5-dien-3-ol (PubChem CID 11098338) has the molecular formula C17H24O2S
and a molecular weight of 292.44 g/mol. Its IUPAC name is 6-methoxy-2,2-dimethyl-4-phenylsulfanylocta-4,5-dien-3-ol.
Molecular Properties
| Compound Name | 6-methoxy-2,2-dimethyl-4-phenylsulfanylocta-4,5-dien-3-ol |
| PubChem CID | 11098338 |
| Molecular Formula | C17H24O2S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 6-methoxy-2,2-dimethyl-4-phenylsulfanylocta-4,5-dien-3-ol |
| SMILES | CCC(=C=C(Sc1ccccc1)C(O)C(C)(C)C)OC |
| InChI | InChI=1S/C17H24O2S/c1-6-13(19-5)12-15(16(18)17(2,3)4)20-14-10-8-7-9-11-14/h7-11,16,18H,6H2,1-5H3 |
| InChIKey | ILBWXEHPGNFIFX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-2,2-dimethyl-4-phenylsulfanylocta-4,5-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2,2-dimethyl-4-phenylsulfanylocta-4,5-dien-3-ol?
The IUPAC name of 6-methoxy-2,2-dimethyl-4-phenylsulfanylocta-4,5-dien-3-ol (CID 11098338) is 6-methoxy-2,2-dimethyl-4-phenylsulfanylocta-4,5-dien-3-ol.
What is the SMILES notation for 6-methoxy-2,2-dimethyl-4-phenylsulfanylocta-4,5-dien-3-ol?
The canonical SMILES for 6-methoxy-2,2-dimethyl-4-phenylsulfanylocta-4,5-dien-3-ol is CCC(=C=C(Sc1ccccc1)C(O)C(C)(C)C)OC.
What is the InChIKey of 6-methoxy-2,2-dimethyl-4-phenylsulfanylocta-4,5-dien-3-ol?
The InChIKey is ILBWXEHPGNFIFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O2S/c1-6-13(19-5)12-15(16(18)17(2,3)4)20-14-10-8-7-9-11-14/h7-11,16,18H,6H2,1-5H3.
What are the key properties of 6-methoxy-2,2-dimethyl-4-phenylsulfanylocta-4,5-dien-3-ol?
6-methoxy-2,2-dimethyl-4-phenylsulfanylocta-4,5-dien-3-ol has a molecular weight of 292.44 g/mol, XLogP of 4.61, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2,2-dimethyl-4-phenylsulfanylocta-4,5-dien-3-ol is sourced from PubChem (CID 11098338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).