C24H26N4O3 — CID 110983380
N-[[6-(2,6-dimethoxyphenoxy)-3-pyridinyl]methyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide (PubChem CID 110983380) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[[6-(2,6-dimethoxyphenoxy)-3-pyridinyl]methyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N-[[6-(2,6-dimethoxyphenoxy)-3-pyridinyl]methyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 110983380 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-[[6-(2,6-dimethoxyphenoxy)-3-pyridinyl]methyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(Oc2c(OC)cccc2OC)nc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C24H26N4O3/c1-25-24(28-14-13-18-7-4-5-8-19(18)28)27-16-17-11-12-22(26-15-17)31-23-20(29-2)9-6-10-21(23)30-3/h4-12,15H,13-14,16H2,1-3H3,(H,25,27) |
| InChIKey | IDNZZUHJKBTFOM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|