C19H32N4 — CID 110983746
N'-[4-(diethylamino)butyl]-N-ethyl-2,3-dihydroindole-1-carboximidamide (PubChem CID 110983746) has the molecular formula C19H32N4 and a molecular weight of 316.49 g/mol. Its IUPAC name is N'-[4-(diethylamino)butyl]-N-ethyl-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N'-[4-(diethylamino)butyl]-N-ethyl-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 110983746 |
| Molecular Formula | C19H32N4 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | N'-[4-(diethylamino)butyl]-N-ethyl-2,3-dihydroindole-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCN(CC)CC)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H32N4/c1-4-20-19(21-14-9-10-15-22(5-2)6-3)23-16-13-17-11-7-8-12-18(17)23/h7-8,11-12H,4-6,9-10,13-16H2,1-3H3,(H,20,21) |
| InChIKey | IMUSTEMPALJRBJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|