C18H19NO3 — CID 11098517
methyl (1R,2S,11R,12S)-9-methyl-10-oxo-9-azatetracyclo[10.2.2.02,11.03,8]hexadeca-3,5,7,13-tetraene-2-carboxylate (PubChem CID 11098517) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is methyl (1R,2S,11R,12S)-9-methyl-10-oxo-9-azatetracyclo[10.2.2.02,11.03,8]hexadeca-3,5,7,13-tetraene-2-carboxylate.
| Compound Name | methyl (1R,2S,11R,12S)-9-methyl-10-oxo-9-azatetracyclo[10.2.2.02,11.03,8]hexadeca-3,5,7,13-tetraene-2-carboxylate |
|---|---|
| PubChem CID | 11098517 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | methyl (1R,2S,11R,12S)-9-methyl-10-oxo-9-azatetracyclo[10.2.2.02,11.03,8]hexadeca-3,5,7,13-tetraene-2-carboxylate |
| SMILES | COC(=O)[C@]12c3ccccc3N(C)C(=O)[C@@H]1[C@@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C18H19NO3/c1-19-14-6-4-3-5-13(14)18(17(21)22-2)12-9-7-11(8-10-12)15(18)16(19)20/h3-7,9,11-12,15H,8,10H2,1-2H3/t11-,12+,15+,18-/m1/s1 |
| InChIKey | SRZAITMSBMUISI-SJECXTJVSA-N |
| XLogP | 2.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|