C19H24F3N5O — CID 110985282
N-ethyl-N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]-2,3-dihydroindole-1-carboximidamide (PubChem CID 110985282) has the molecular formula C19H24F3N5O and a molecular weight of 395.43 g/mol. Its IUPAC name is N-ethyl-N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N-ethyl-N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 110985282 |
| Molecular Formula | C19H24F3N5O |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-ethyl-N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]-2,3-dihydroindole-1-carboximidamide |
| SMILES | CCN/C(=N\CCC(O)(c1nccn1C)C(F)(F)F)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H24F3N5O/c1-3-23-17(27-12-8-14-6-4-5-7-15(14)27)25-10-9-18(28,19(20,21)22)16-24-11-13-26(16)2/h4-7,11,13,28H,3,8-10,12H2,1-2H3,(H,23,25) |
| InChIKey | ORTLMRKCXRLINN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|