C16H26O5 — CID 11098551
(4R,5R)-4-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-prop-2-enoxymethyl]-5-ethenyl-2,2-dimethyl-1,3-dioxolane (PubChem CID 11098551) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is (4R,5R)-4-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-prop-2-enoxymethyl]-5-ethenyl-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-prop-2-enoxymethyl]-5-ethenyl-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11098551 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (4R,5R)-4-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-prop-2-enoxymethyl]-5-ethenyl-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=CCO[C@@H]([C@@H]1OC(C)(C)O[C@@H]1C=C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H26O5/c1-7-9-17-13(12-10-18-15(3,4)20-12)14-11(8-2)19-16(5,6)21-14/h7-8,11-14H,1-2,9-10H2,3-6H3/t11-,12-,13-,14-/m1/s1 |
| InChIKey | UBKIWZBJRSLPST-AAVRWANBSA-N |
| XLogP | 2.42 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|