C14H21NO6 — CID 11098574
7-O-tert-butyl 8-O-methyl (8S)-2-oxo-1-oxa-7-azaspiro[4.4]nonane-7,8-dicarboxylate (PubChem CID 11098574) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is 7-O-tert-butyl 8-O-methyl (8S)-2-oxo-1-oxa-7-azaspiro[4.4]nonane-7,8-dicarboxylate.
| Compound Name | 7-O-tert-butyl 8-O-methyl (8S)-2-oxo-1-oxa-7-azaspiro[4.4]nonane-7,8-dicarboxylate |
|---|---|
| PubChem CID | 11098574 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 7-O-tert-butyl 8-O-methyl (8S)-2-oxo-1-oxa-7-azaspiro[4.4]nonane-7,8-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC2(CCC(=O)O2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21NO6/c1-13(2,3)21-12(18)15-8-14(6-5-10(16)20-14)7-9(15)11(17)19-4/h9H,5-8H2,1-4H3/t9-,14?/m0/s1 |
| InChIKey | IKWDBLLKWFMNSR-CUVJYRNJSA-N |
| XLogP | 1.24 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|