C17H20O3S — CID 11098752
(1R,5S,8S)-8-(dimethoxymethyl)-3-phenylsulfanylbicyclo[3.2.1]oct-6-en-2-one (PubChem CID 11098752) has the molecular formula C17H20O3S and a molecular weight of 304.41 g/mol. Its IUPAC name is (1R,5S,8S)-8-(dimethoxymethyl)-3-phenylsulfanylbicyclo[3.2.1]oct-6-en-2-one.
| Compound Name | (1R,5S,8S)-8-(dimethoxymethyl)-3-phenylsulfanylbicyclo[3.2.1]oct-6-en-2-one |
|---|---|
| PubChem CID | 11098752 |
| Molecular Formula | C17H20O3S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (1R,5S,8S)-8-(dimethoxymethyl)-3-phenylsulfanylbicyclo[3.2.1]oct-6-en-2-one |
| SMILES | COC(OC)[C@H]1[C@@H]2C=C[C@H]1C(=O)C(Sc1ccccc1)C2 |
| InChI | InChI=1S/C17H20O3S/c1-19-17(20-2)15-11-8-9-13(15)16(18)14(10-11)21-12-6-4-3-5-7-12/h3-9,11,13-15,17H,10H2,1-2H3/t11-,13-,14?,15+/m1/s1 |
| InChIKey | KYXITLNAIKTEQL-IBEYCOPNSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|