C16H23N5O2 — CID 110987686
N-(2-amino-2-oxoethyl)-4-[[[(cyclopropylamino)-(ethylamino)methylidene]amino]methyl]benzamide (PubChem CID 110987686) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[(cyclopropylamino)-(ethylamino)methylidene]amino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[(cyclopropylamino)-(ethylamino)methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 110987686 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[(cyclopropylamino)-(ethylamino)methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NCC(N)=O)cc1)NC1CC1 |
| InChI | InChI=1S/C16H23N5O2/c1-2-18-16(21-13-7-8-13)20-9-11-3-5-12(6-4-11)15(23)19-10-14(17)22/h3-6,13H,2,7-10H2,1H3,(H2,17,22)(H,19,23)(H2,18,20,21) |
| InChIKey | HTIYUNVGMNJZRQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|