C14H22IN3S — CID 110987779
1-cyclopropyl-3-ethyl-2-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide (PubChem CID 110987779) has the molecular formula C14H22IN3S and a molecular weight of 391.32 g/mol. Its IUPAC name is 1-cyclopropyl-3-ethyl-2-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-3-ethyl-2-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110987779 |
| Molecular Formula | C14H22IN3S |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 1-cyclopropyl-3-ethyl-2-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(SC)cc1)NC1CC1.I |
| InChI | InChI=1S/C14H21N3S.HI/c1-3-15-14(17-12-6-7-12)16-10-11-4-8-13(18-2)9-5-11;/h4-5,8-9,12H,3,6-7,10H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | JNIVIGDCVQFDTR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|