C16H20O6 — CID 11098875
(5Z,9R)-9-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-4,7-dihydrooxonine-2,3,8-trione (PubChem CID 11098875) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is (5Z,9R)-9-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-4,7-dihydrooxonine-2,3,8-trione.
| Compound Name | (5Z,9R)-9-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-4,7-dihydrooxonine-2,3,8-trione |
|---|---|
| PubChem CID | 11098875 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (5Z,9R)-9-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-4,7-dihydrooxonine-2,3,8-trione |
| SMILES | O=C1C/C=C\CC(=O)[C@@H]([C@@H]2COC3(CCCCC3)O2)OC1=O |
| InChI | InChI=1S/C16H20O6/c17-11-6-2-3-7-12(18)15(19)21-14(11)13-10-20-16(22-13)8-4-1-5-9-16/h2-3,13-14H,1,4-10H2/b3-2-/t13-,14-/m0/s1 |
| InChIKey | OZPLVXURRXIRLQ-PQXPCTDFSA-N |
| XLogP | 1.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|