C17H28IN3O2 — CID 110989094
1-cyclopropyl-3-ethyl-2-[3-[(4-methoxyphenyl)methoxy]propyl]guanidine;hydroiodide (PubChem CID 110989094) has the molecular formula C17H28IN3O2 and a molecular weight of 433.33 g/mol. Its IUPAC name is 1-cyclopropyl-3-ethyl-2-[3-[(4-methoxyphenyl)methoxy]propyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-3-ethyl-2-[3-[(4-methoxyphenyl)methoxy]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110989094 |
| Molecular Formula | C17H28IN3O2 |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 1-cyclopropyl-3-ethyl-2-[3-[(4-methoxyphenyl)methoxy]propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOCc1ccc(OC)cc1)NC1CC1.I |
| InChI | InChI=1S/C17H27N3O2.HI/c1-3-18-17(20-15-7-8-15)19-11-4-12-22-13-14-5-9-16(21-2)10-6-14;/h5-6,9-10,15H,3-4,7-8,11-13H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | GMXUYNQRGRMEMT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|