About methyl 3,8-dihydroxy-1-methyl-9,10-dioxoanthracene-2-carboxylate
methyl 3,8-dihydroxy-1-methyl-9,10-dioxoanthracene-2-carboxylate (PubChem CID 11098986) has the molecular formula C17H12O6
and a molecular weight of 312.28 g/mol. Its IUPAC name is methyl 3,8-dihydroxy-1-methyl-9,10-dioxoanthracene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3,8-dihydroxy-1-methyl-9,10-dioxoanthracene-2-carboxylate |
| PubChem CID | 11098986 |
| Molecular Formula | C17H12O6 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | methyl 3,8-dihydroxy-1-methyl-9,10-dioxoanthracene-2-carboxylate |
| SMILES | COC(=O)c1c(O)cc2c(c1C)C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C17H12O6/c1-7-12-9(6-11(19)13(7)17(22)23-2)15(20)8-4-3-5-10(18)14(8)16(12)21/h3-6,18-19H,1-2H3 |
| InChIKey | OWMIPWWYWUGBCG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze methyl 3,8-dihydroxy-1-methyl-9,10-dioxoanthracene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3,8-dihydroxy-1-methyl-9,10-dioxoanthracene-2-carboxylate?
The IUPAC name of methyl 3,8-dihydroxy-1-methyl-9,10-dioxoanthracene-2-carboxylate (CID 11098986) is methyl 3,8-dihydroxy-1-methyl-9,10-dioxoanthracene-2-carboxylate.
What is the SMILES notation for methyl 3,8-dihydroxy-1-methyl-9,10-dioxoanthracene-2-carboxylate?
The canonical SMILES for methyl 3,8-dihydroxy-1-methyl-9,10-dioxoanthracene-2-carboxylate is COC(=O)c1c(O)cc2c(c1C)C(=O)c1c(O)cccc1C2=O.
What is the InChIKey of methyl 3,8-dihydroxy-1-methyl-9,10-dioxoanthracene-2-carboxylate?
The InChIKey is OWMIPWWYWUGBCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O6/c1-7-12-9(6-11(19)13(7)17(22)23-2)15(20)8-4-3-5-10(18)14(8)16(12)21/h3-6,18-19H,1-2H3.
What are the key properties of methyl 3,8-dihydroxy-1-methyl-9,10-dioxoanthracene-2-carboxylate?
methyl 3,8-dihydroxy-1-methyl-9,10-dioxoanthracene-2-carboxylate has a molecular weight of 312.28 g/mol, XLogP of 1.97, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,8-dihydroxy-1-methyl-9,10-dioxoanthracene-2-carboxylate is sourced from PubChem (CID 11098986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).