C12H14N2O2S3 — CID 11099066
N-(2-hydroxyethyl)-2-sulfanyl-3-(2-thiophen-2-yl-1,3-thiazol-4-yl)propanamide (PubChem CID 11099066) has the molecular formula C12H14N2O2S3 and a molecular weight of 314.46 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-sulfanyl-3-(2-thiophen-2-yl-1,3-thiazol-4-yl)propanamide.
| Compound Name | N-(2-hydroxyethyl)-2-sulfanyl-3-(2-thiophen-2-yl-1,3-thiazol-4-yl)propanamide |
|---|---|
| PubChem CID | 11099066 |
| Molecular Formula | C12H14N2O2S3 |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | N-(2-hydroxyethyl)-2-sulfanyl-3-(2-thiophen-2-yl-1,3-thiazol-4-yl)propanamide |
| SMILES | O=C(NCCO)C(S)Cc1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C12H14N2O2S3/c15-4-3-13-11(16)9(17)6-8-7-19-12(14-8)10-2-1-5-18-10/h1-2,5,7,9,15,17H,3-4,6H2,(H,13,16) |
| InChIKey | UKUXAUFTGXVNTQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|