C14H24O6Si — CID 11099128
dimethyl 2,2,5-trimethyl-5-trimethylsilyloxyfuran-3,4-dicarboxylate (PubChem CID 11099128) has the molecular formula C14H24O6Si and a molecular weight of 316.43 g/mol. Its IUPAC name is dimethyl 2,2,5-trimethyl-5-trimethylsilyloxyfuran-3,4-dicarboxylate.
| Compound Name | dimethyl 2,2,5-trimethyl-5-trimethylsilyloxyfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11099128 |
| Molecular Formula | C14H24O6Si |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | dimethyl 2,2,5-trimethyl-5-trimethylsilyloxyfuran-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C)(O[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C14H24O6Si/c1-13(2)9(11(15)17-4)10(12(16)18-5)14(3,19-13)20-21(6,7)8/h1-8H3 |
| InChIKey | YMDCACUYOAUYJG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|