C22H36O — CID 11099138
(1Z,3E,7E,11E)-2-ethoxy-4,8,12-trimethyl-1-propan-2-ylcyclotetradeca-1,3,7,11-tetraene (PubChem CID 11099138) has the molecular formula C22H36O and a molecular weight of 316.53 g/mol. Its IUPAC name is (1Z,3E,7E,11E)-2-ethoxy-4,8,12-trimethyl-1-propan-2-ylcyclotetradeca-1,3,7,11-tetraene.
| Compound Name | (1Z,3E,7E,11E)-2-ethoxy-4,8,12-trimethyl-1-propan-2-ylcyclotetradeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 11099138 |
| Molecular Formula | C22H36O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | (1Z,3E,7E,11E)-2-ethoxy-4,8,12-trimethyl-1-propan-2-ylcyclotetradeca-1,3,7,11-tetraene |
| SMILES | CCOC1=C(\C(C)C)CC/C(C)=C/CC/C(C)=C/CC\C(C)=C\1 |
| InChI | InChI=1S/C22H36O/c1-7-23-22-16-20(6)13-9-11-18(4)10-8-12-19(5)14-15-21(22)17(2)3/h11-12,16-17H,7-10,13-15H2,1-6H3/b18-11+,19-12+,20-16+,22-21- |
| InChIKey | GKVJDBSSPQHGOH-GLFBJANHSA-N |
| XLogP | 7.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|