C17H29IN4OS — CID 110991592
1-cyclopentyl-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 110991592) has the molecular formula C17H29IN4OS and a molecular weight of 464.42 g/mol. Its IUPAC name is 1-cyclopentyl-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-cyclopentyl-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110991592 |
| Molecular Formula | C17H29IN4OS |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 1-cyclopentyl-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(c1cccs1)N1CCOCC1)NC1CCCC1.I |
| InChI | InChI=1S/C17H28N4OS.HI/c1-18-17(20-14-5-2-3-6-14)19-13-15(16-7-4-12-23-16)21-8-10-22-11-9-21;/h4,7,12,14-15H,2-3,5-6,8-11,13H2,1H3,(H2,18,19,20);1H |
| InChIKey | MMGLHOORQVUGEF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|