C18H22O5 — CID 11099186
dimethyl (1S,2S,11R,12R)-15-oxatetracyclo[10.2.1.02,11.03,10]pentadeca-3(10),13-diene-13,14-dicarboxylate (PubChem CID 11099186) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is dimethyl (1S,2S,11R,12R)-15-oxatetracyclo[10.2.1.02,11.03,10]pentadeca-3(10),13-diene-13,14-dicarboxylate.
| Compound Name | dimethyl (1S,2S,11R,12R)-15-oxatetracyclo[10.2.1.02,11.03,10]pentadeca-3(10),13-diene-13,14-dicarboxylate |
|---|---|
| PubChem CID | 11099186 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | dimethyl (1S,2S,11R,12R)-15-oxatetracyclo[10.2.1.02,11.03,10]pentadeca-3(10),13-diene-13,14-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2O[C@H]1[C@@H]1C3=C(CCCCCC3)[C@@H]12 |
| InChI | InChI=1S/C18H22O5/c1-21-17(19)13-14(18(20)22-2)16-12-10-8-6-4-3-5-7-9(10)11(12)15(13)23-16/h11-12,15-16H,3-8H2,1-2H3/t11-,12+,15+,16- |
| InChIKey | SEWPSFSMEUAESJ-CRJCFHLZSA-N |
| XLogP | 2.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|