potassium bis(trifluoromethylsulfonyl)azanide

C2F6KNO4S2 — CID 11099217

IUPACpotassium bis(trifluoromethylsulfonyl)azanide
SMILESO=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[K+]
InChIInChI=1S/C2F6NO4S2.K/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/q-1;+1
InChIKeyKVFIZLDWRFTUEM-UHFFFAOYSA-N
MW319.25 g/mol
LogP-1.94
Rot. Bonds2

About potassium bis(trifluoromethylsulfonyl)azanide

potassium bis(trifluoromethylsulfonyl)azanide (PubChem CID 11099217) has the molecular formula C2F6KNO4S2 and a molecular weight of 319.25 g/mol. Its IUPAC name is potassium bis(trifluoromethylsulfonyl)azanide.

Molecular Properties

Compound Namepotassium bis(trifluoromethylsulfonyl)azanide
PubChem CID11099217
Molecular FormulaC2F6KNO4S2
Molecular Weight319.25 g/mol
Exact Mass318.88
IUPAC Namepotassium bis(trifluoromethylsulfonyl)azanide
SMILESO=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[K+]
InChIInChI=1S/C2F6NO4S2.K/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/q-1;+1
InChIKeyKVFIZLDWRFTUEM-UHFFFAOYSA-N
XLogP-1.94
TPSA82.38 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.25
LogP ≤ 5-1.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze potassium bis(trifluoromethylsulfonyl)azanide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium bis(trifluoromethylsulfonyl)azanide?
The IUPAC name of potassium bis(trifluoromethylsulfonyl)azanide (CID 11099217) is potassium bis(trifluoromethylsulfonyl)azanide.
What is the SMILES notation for potassium bis(trifluoromethylsulfonyl)azanide?
The canonical SMILES for potassium bis(trifluoromethylsulfonyl)azanide is O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[K+].
What is the InChIKey of potassium bis(trifluoromethylsulfonyl)azanide?
The InChIKey is KVFIZLDWRFTUEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2F6NO4S2.K/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/q-1;+1.
What are the key properties of potassium bis(trifluoromethylsulfonyl)azanide?
potassium bis(trifluoromethylsulfonyl)azanide has a molecular weight of 319.25 g/mol, XLogP of -1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium bis(trifluoromethylsulfonyl)azanide is sourced from PubChem (CID 11099217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).