About [difluoro(phenyl)-λ4-tellanyl]benzene
[difluoro(phenyl)-λ4-tellanyl]benzene (PubChem CID 11099241) has the molecular formula C12H10F2Te
and a molecular weight of 319.81 g/mol. Its IUPAC name is [difluoro(phenyl)-λ4-tellanyl]benzene.
Molecular Properties
| Compound Name | [difluoro(phenyl)-λ4-tellanyl]benzene |
| PubChem CID | 11099241 |
| Molecular Formula | C12H10F2Te |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | [difluoro(phenyl)-λ4-tellanyl]benzene |
| SMILES | F[Te](F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10F2Te/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | AKIXNFDZORPYFR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [difluoro(phenyl)-λ4-tellanyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [difluoro(phenyl)-λ4-tellanyl]benzene?
The IUPAC name of [difluoro(phenyl)-λ4-tellanyl]benzene (CID 11099241) is [difluoro(phenyl)-λ4-tellanyl]benzene.
What is the SMILES notation for [difluoro(phenyl)-λ4-tellanyl]benzene?
The canonical SMILES for [difluoro(phenyl)-λ4-tellanyl]benzene is F[Te](F)(c1ccccc1)c1ccccc1.
What is the InChIKey of [difluoro(phenyl)-λ4-tellanyl]benzene?
The InChIKey is AKIXNFDZORPYFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2Te/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H.
What are the key properties of [difluoro(phenyl)-λ4-tellanyl]benzene?
[difluoro(phenyl)-λ4-tellanyl]benzene has a molecular weight of 319.81 g/mol, XLogP of 2.18, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [difluoro(phenyl)-λ4-tellanyl]benzene is sourced from PubChem (CID 11099241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).