About (2S)-N-[(1R)-2,2-diethoxy-1-phenylethyl]-2-(methoxymethyl)pyrrolidin-1-amine
(2S)-N-[(1R)-2,2-diethoxy-1-phenylethyl]-2-(methoxymethyl)pyrrolidin-1-amine (PubChem CID 11099327) has the molecular formula C18H30N2O3
and a molecular weight of 322.45 g/mol. Its IUPAC name is (2S)-N-[(1R)-2,2-diethoxy-1-phenylethyl]-2-(methoxymethyl)pyrrolidin-1-amine.
Molecular Properties
| Compound Name | (2S)-N-[(1R)-2,2-diethoxy-1-phenylethyl]-2-(methoxymethyl)pyrrolidin-1-amine |
| PubChem CID | 11099327 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (2S)-N-[(1R)-2,2-diethoxy-1-phenylethyl]-2-(methoxymethyl)pyrrolidin-1-amine |
| SMILES | CCOC(OCC)[C@H](NN1CCC[C@H]1COC)c1ccccc1 |
| InChI | InChI=1S/C18H30N2O3/c1-4-22-18(23-5-2)17(15-10-7-6-8-11-15)19-20-13-9-12-16(20)14-21-3/h6-8,10-11,16-19H,4-5,9,12-14H2,1-3H3/t16-,17+/m0/s1 |
| InChIKey | XFYRNDXRLHLNGE-DLBZAZTESA-N |
| XLogP | 2.74 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N-[(1R)-2,2-diethoxy-1-phenylethyl]-2-(methoxymethyl)pyrrolidin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[(1R)-2,2-diethoxy-1-phenylethyl]-2-(methoxymethyl)pyrrolidin-1-amine?
The IUPAC name of (2S)-N-[(1R)-2,2-diethoxy-1-phenylethyl]-2-(methoxymethyl)pyrrolidin-1-amine (CID 11099327) is (2S)-N-[(1R)-2,2-diethoxy-1-phenylethyl]-2-(methoxymethyl)pyrrolidin-1-amine.
What is the SMILES notation for (2S)-N-[(1R)-2,2-diethoxy-1-phenylethyl]-2-(methoxymethyl)pyrrolidin-1-amine?
The canonical SMILES for (2S)-N-[(1R)-2,2-diethoxy-1-phenylethyl]-2-(methoxymethyl)pyrrolidin-1-amine is CCOC(OCC)[C@H](NN1CCC[C@H]1COC)c1ccccc1.
What is the InChIKey of (2S)-N-[(1R)-2,2-diethoxy-1-phenylethyl]-2-(methoxymethyl)pyrrolidin-1-amine?
The InChIKey is XFYRNDXRLHLNGE-DLBZAZTESA-N. The full InChI is InChI=1S/C18H30N2O3/c1-4-22-18(23-5-2)17(15-10-7-6-8-11-15)19-20-13-9-12-16(20)14-21-3/h6-8,10-11,16-19H,4-5,9,12-14H2,1-3H3/t16-,17+/m0/s1.
What are the key properties of (2S)-N-[(1R)-2,2-diethoxy-1-phenylethyl]-2-(methoxymethyl)pyrrolidin-1-amine?
(2S)-N-[(1R)-2,2-diethoxy-1-phenylethyl]-2-(methoxymethyl)pyrrolidin-1-amine has a molecular weight of 322.45 g/mol, XLogP of 2.74, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[(1R)-2,2-diethoxy-1-phenylethyl]-2-(methoxymethyl)pyrrolidin-1-amine is sourced from PubChem (CID 11099327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).