C16H29F3IN3O3 — CID 110993318
ethyl 1-[N-ethyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110993318) has the molecular formula C16H29F3IN3O3 and a molecular weight of 495.32 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-ethyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110993318 |
| Molecular Formula | C16H29F3IN3O3 |
| Molecular Weight | 495.32 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC(F)(F)F)N1CCCC(C(=O)OCC)C1.I |
| InChI | InChI=1S/C16H28F3N3O3.HI/c1-3-20-15(21-8-6-10-24-12-16(17,18)19)22-9-5-7-13(11-22)14(23)25-4-2;/h13H,3-12H2,1-2H3,(H,20,21);1H |
| InChIKey | UADHQPHJHNEVRD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|